C25H37NO5S — CID 85070408
4,8-dihydroxy-5,5,7-trimethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 85070408) has the molecular formula C25H37NO5S and a molecular weight of 463.64 g/mol. Its IUPAC name is 4,8-dihydroxy-5,5,7-trimethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | 4,8-dihydroxy-5,5,7-trimethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 85070408 |
| Molecular Formula | C25H37NO5S |
| Molecular Weight | 463.64 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 4,8-dihydroxy-5,5,7-trimethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | CC(=Cc1csc(C)n1)C1CC=CCCCCC(O)C(C)C(=O)C(C)(C)C(O)CC(=O)O1 |
| InChI | InChI=1S/C25H37NO5S/c1-16(13-19-15-32-18(3)26-19)21-12-10-8-6-7-9-11-20(27)17(2)24(30)25(4,5)22(28)14-23(29)31-21/h8,10,13,15,17,20-22,27-28H,6-7,9,11-12,14H2,1-5H3 |
| InChIKey | BQWMEQIBCWMVHJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.64 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|