C27H43NO4S — CID 118476388
(4S,7R,8S,9S)-4-hydroxy-5,5,7,8,9-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-oxacyclohexadecane-2,6-dione (PubChem CID 118476388) has the molecular formula C27H43NO4S and a molecular weight of 477.71 g/mol. Its IUPAC name is (4S,7R,8S,9S)-4-hydroxy-5,5,7,8,9-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-oxacyclohexadecane-2,6-dione.
| Compound Name | (4S,7R,8S,9S)-4-hydroxy-5,5,7,8,9-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-oxacyclohexadecane-2,6-dione |
|---|---|
| PubChem CID | 118476388 |
| Molecular Formula | C27H43NO4S |
| Molecular Weight | 477.71 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | (4S,7R,8S,9S)-4-hydroxy-5,5,7,8,9-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-oxacyclohexadecane-2,6-dione |
| SMILES | C/C(=C\c1csc(C)n1)C1CCCCCC[C@H](C)[C@H](C)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C27H43NO4S/c1-17-12-10-8-9-11-13-23(18(2)14-22-16-33-21(5)28-22)32-25(30)15-24(29)27(6,7)26(31)20(4)19(17)3/h14,16-17,19-20,23-24,29H,8-13,15H2,1-7H3/b18-14+/t17-,19-,20+,23?,24-/m0/s1 |
| InChIKey | AGBNOBCKWHEKQU-NDOKQUBVSA-N |
| XLogP | 6.38 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.71 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |