C26H24ClNO5 — CID 142083985
2-[4-chloro-2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]propane-1,1-diol (PubChem CID 142083985) has the molecular formula C26H24ClNO5 and a molecular weight of 465.93 g/mol. Its IUPAC name is 2-[4-chloro-2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]propane-1,1-diol.
| Compound Name | 2-[4-chloro-2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]propane-1,1-diol |
|---|---|
| PubChem CID | 142083985 |
| Molecular Formula | C26H24ClNO5 |
| Molecular Weight | 465.93 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 2-[4-chloro-2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]propane-1,1-diol |
| SMILES | CC(Oc1ccc(Cl)cc1COc1cccc(OCc2ccc3ccccc3n2)c1)C(O)O |
| InChI | InChI=1S/C26H24ClNO5/c1-17(26(29)30)33-25-12-10-20(27)13-19(25)15-31-22-6-4-7-23(14-22)32-16-21-11-9-18-5-2-3-8-24(18)28-21/h2-14,17,26,29-30H,15-16H2,1H3 |
| InChIKey | OAFRPSFPMMAMFQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.93 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|