C27H24ClNO4 — CID 18727418
3-[4-chloro-2-[[4-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]butan-2-one (PubChem CID 18727418) has the molecular formula C27H24ClNO4 and a molecular weight of 461.95 g/mol. Its IUPAC name is 3-[4-chloro-2-[[4-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]butan-2-one.
| Compound Name | 3-[4-chloro-2-[[4-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]butan-2-one |
|---|---|
| PubChem CID | 18727418 |
| Molecular Formula | C27H24ClNO4 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 3-[4-chloro-2-[[4-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]butan-2-one |
| SMILES | CC(=O)C(C)Oc1ccc(Cl)cc1COc1ccc(OCc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C27H24ClNO4/c1-18(30)19(2)33-27-14-8-22(28)15-21(27)16-31-24-10-12-25(13-11-24)32-17-23-9-7-20-5-3-4-6-26(20)29-23/h3-15,19H,16-17H2,1-2H3 |
| InChIKey | XSIQZAKEDMLNGR-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |