About methyl N-buta-1,3-dien-2-ylmethanimidate
methyl N-buta-1,3-dien-2-ylmethanimidate (PubChem CID 142084338) has the molecular formula C6H9NO
and a molecular weight of 111.14 g/mol. Its IUPAC name is methyl N-buta-1,3-dien-2-ylmethanimidate.
Molecular Properties
| Compound Name | methyl N-buta-1,3-dien-2-ylmethanimidate |
| PubChem CID | 142084338 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | methyl N-buta-1,3-dien-2-ylmethanimidate |
| SMILES | C=CC(=C)/N=C/OC |
| InChI | InChI=1S/C6H9NO/c1-4-6(2)7-5-8-3/h4-5H,1-2H2,3H3/b7-5+ |
| InChIKey | YDRBOPYCXAZJGY-FNORWQNLSA-N |
| XLogP | 1.36 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl N-buta-1,3-dien-2-ylmethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-buta-1,3-dien-2-ylmethanimidate?
The IUPAC name of methyl N-buta-1,3-dien-2-ylmethanimidate (CID 142084338) is methyl N-buta-1,3-dien-2-ylmethanimidate.
What is the SMILES notation for methyl N-buta-1,3-dien-2-ylmethanimidate?
The canonical SMILES for methyl N-buta-1,3-dien-2-ylmethanimidate is C=CC(=C)/N=C/OC.
What is the InChIKey of methyl N-buta-1,3-dien-2-ylmethanimidate?
The InChIKey is YDRBOPYCXAZJGY-FNORWQNLSA-N. The full InChI is InChI=1S/C6H9NO/c1-4-6(2)7-5-8-3/h4-5H,1-2H2,3H3/b7-5+.
What are the key properties of methyl N-buta-1,3-dien-2-ylmethanimidate?
methyl N-buta-1,3-dien-2-ylmethanimidate has a molecular weight of 111.14 g/mol, XLogP of 1.36, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-buta-1,3-dien-2-ylmethanimidate is sourced from PubChem (CID 142084338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).