C7H11NO — CID 163838619
methyl N-[(2Z)-penta-2,4-dien-2-yl]methanimidate (PubChem CID 163838619) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is methyl N-[(2Z)-penta-2,4-dien-2-yl]methanimidate.
| Compound Name | methyl N-[(2Z)-penta-2,4-dien-2-yl]methanimidate |
|---|---|
| PubChem CID | 163838619 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | methyl N-[(2Z)-penta-2,4-dien-2-yl]methanimidate |
| SMILES | C=C/C=C(C)\N=C\OC |
| InChI | InChI=1S/C7H11NO/c1-4-5-7(2)8-6-9-3/h4-6H,1H2,2-3H3/b7-5-,8-6+ |
| InChIKey | OJZAOOOSODBEGL-CGXWXWIYSA-N |
| XLogP | 1.75 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|