C15H26FNO — CID 142084753
(6Z)-4-ethoxy-8-fluoro-N,N,4-trimethyl-5-methylidenenona-6,8-dien-1-amine (PubChem CID 142084753) has the molecular formula C15H26FNO and a molecular weight of 255.38 g/mol. Its IUPAC name is (6Z)-4-ethoxy-8-fluoro-N,N,4-trimethyl-5-methylidenenona-6,8-dien-1-amine.
| Compound Name | (6Z)-4-ethoxy-8-fluoro-N,N,4-trimethyl-5-methylidenenona-6,8-dien-1-amine |
|---|---|
| PubChem CID | 142084753 |
| Molecular Formula | C15H26FNO |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | (6Z)-4-ethoxy-8-fluoro-N,N,4-trimethyl-5-methylidenenona-6,8-dien-1-amine |
| SMILES | C=C(F)/C=C\C(=C)C(C)(CCCN(C)C)OCC |
| InChI | InChI=1S/C15H26FNO/c1-7-18-15(4,11-8-12-17(5)6)13(2)9-10-14(3)16/h9-10H,2-3,7-8,11-12H2,1,4-6H3/b10-9- |
| InChIKey | YUBSKKPTXVPLQQ-KTKRTIGZSA-N |
| XLogP | 3.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|