C15H26FNO — CID 144635931
(4E,6E)-N-ethyl-7-fluoro-3-methoxy-N,3-dimethyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-amine (PubChem CID 144635931) has the molecular formula C15H26FNO and a molecular weight of 255.38 g/mol. Its IUPAC name is (4E,6E)-N-ethyl-7-fluoro-3-methoxy-N,3-dimethyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-amine.
| Compound Name | (4E,6E)-N-ethyl-7-fluoro-3-methoxy-N,3-dimethyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 144635931 |
| Molecular Formula | C15H26FNO |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | (4E,6E)-N-ethyl-7-fluoro-3-methoxy-N,3-dimethyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-amine |
| SMILES | C/C=C\C(=C/C=C/F)C(C)(CCN(C)CC)OC |
| InChI | InChI=1S/C15H26FNO/c1-6-9-14(10-8-12-16)15(3,18-5)11-13-17(4)7-2/h6,8-10,12H,7,11,13H2,1-5H3/b9-6-,12-8+,14-10+ |
| InChIKey | MMOMBZUXNCHWEA-AOLYZAOJSA-N |
| XLogP | 3.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|