C15H27NO — CID 144802236
ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]-4-methoxy-1-methylpiperidine (PubChem CID 144802236) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]-4-methoxy-1-methylpiperidine.
| Compound Name | ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]-4-methoxy-1-methylpiperidine |
|---|---|
| PubChem CID | 144802236 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]-4-methoxy-1-methylpiperidine |
| SMILES | C=C/C=C(\C=C)C1(OC)CCN(C)CC1.CC |
| InChI | InChI=1S/C13H21NO.C2H6/c1-5-7-12(6-2)13(15-4)8-10-14(3)11-9-13;1-2/h5-7H,1-2,8-11H2,3-4H3;1-2H3/b12-7+; |
| InChIKey | KTLQTNBTVYNFMU-RRAJOLSVSA-N |
| XLogP | 3.42 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|