C17H31NO — CID 142861523
ethane;4-methoxy-1-methyl-4-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]piperidine (PubChem CID 142861523) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is ethane;4-methoxy-1-methyl-4-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]piperidine.
| Compound Name | ethane;4-methoxy-1-methyl-4-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]piperidine |
|---|---|
| PubChem CID | 142861523 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | ethane;4-methoxy-1-methyl-4-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]piperidine |
| SMILES | C=C/C=C\C(=C(C)C)C1(OC)CCN(C)CC1.CC |
| InChI | InChI=1S/C15H25NO.C2H6/c1-6-7-8-14(13(2)3)15(17-5)9-11-16(4)12-10-15;1-2/h6-8H,1,9-12H2,2-5H3;1-2H3/b8-7-; |
| InChIKey | OAHRYEPWRNBDHD-CFYXSCKTSA-N |
| XLogP | 4.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|