C22H40N2O — CID 90970266
N-ethyl-4-(4-hepta-2,4,6-trien-2-yl-1-methylpiperidin-4-yl)oxy-N,4-dimethylpentan-2-amine (PubChem CID 90970266) has the molecular formula C22H40N2O and a molecular weight of 348.58 g/mol. Its IUPAC name is N-ethyl-4-(4-hepta-2,4,6-trien-2-yl-1-methylpiperidin-4-yl)oxy-N,4-dimethylpentan-2-amine.
| Compound Name | N-ethyl-4-(4-hepta-2,4,6-trien-2-yl-1-methylpiperidin-4-yl)oxy-N,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 90970266 |
| Molecular Formula | C22H40N2O |
| Molecular Weight | 348.58 g/mol |
| Exact Mass | 348.31 |
| IUPAC Name | N-ethyl-4-(4-hepta-2,4,6-trien-2-yl-1-methylpiperidin-4-yl)oxy-N,4-dimethylpentan-2-amine |
| SMILES | C=CC=CC=C(C)C1(OC(C)(C)CC(C)N(C)CC)CCN(C)CC1 |
| InChI | InChI=1S/C22H40N2O/c1-9-11-12-13-19(3)22(14-16-23(7)17-15-22)25-21(5,6)18-20(4)24(8)10-2/h9,11-13,20H,1,10,14-18H2,2-8H3 |
| InChIKey | IJHDGBIZVIPHOC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.58 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|