C21H21F3IN3O4 — CID 142085424
iodo 3-[[N-[[4-(trifluoromethoxy)phenyl]carbamoyl]anilino]methyl]piperidine-1-carboxylate (PubChem CID 142085424) has the molecular formula C21H21F3IN3O4 and a molecular weight of 563.31 g/mol. Its IUPAC name is iodo 3-[[N-[[4-(trifluoromethoxy)phenyl]carbamoyl]anilino]methyl]piperidine-1-carboxylate.
| Compound Name | iodo 3-[[N-[[4-(trifluoromethoxy)phenyl]carbamoyl]anilino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142085424 |
| Molecular Formula | C21H21F3IN3O4 |
| Molecular Weight | 563.31 g/mol |
| Exact Mass | 563.05 |
| IUPAC Name | iodo 3-[[N-[[4-(trifluoromethoxy)phenyl]carbamoyl]anilino]methyl]piperidine-1-carboxylate |
| SMILES | O=C(OI)N1CCCC(CN(C(=O)Nc2ccc(OC(F)(F)F)cc2)c2ccccc2)C1 |
| InChI | InChI=1S/C21H21F3IN3O4/c22-21(23,24)31-18-10-8-16(9-11-18)26-19(29)28(17-6-2-1-3-7-17)14-15-5-4-12-27(13-15)20(30)32-25/h1-3,6-11,15H,4-5,12-14H2,(H,26,29) |
| InChIKey | APBRZONADJWDJK-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.31 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|