About (E)-2-amino-3-(2-amino-4-methylphenyl)-3-hydroxyprop-2-enoic acid;ethane;yttrium
(E)-2-amino-3-(2-amino-4-methylphenyl)-3-hydroxyprop-2-enoic acid;ethane;yttrium (PubChem CID 142087139) has the molecular formula C12H18N2O3Y
and a molecular weight of 327.19 g/mol. Its IUPAC name is (E)-2-amino-3-(2-amino-4-methylphenyl)-3-hydroxyprop-2-enoic acid;ethane;yttrium.
Molecular Properties
| Compound Name | (E)-2-amino-3-(2-amino-4-methylphenyl)-3-hydroxyprop-2-enoic acid;ethane;yttrium |
| PubChem CID | 142087139 |
| Molecular Formula | C12H18N2O3Y |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | (E)-2-amino-3-(2-amino-4-methylphenyl)-3-hydroxyprop-2-enoic acid;ethane;yttrium |
| SMILES | CC.Cc1ccc(/C(O)=C(\N)C(=O)O)c(N)c1.[Y] |
| InChI | InChI=1S/C10H12N2O3.C2H6.Y/c1-5-2-3-6(7(11)4-5)9(13)8(12)10(14)15;1-2;/h2-4,13H,11-12H2,1H3,(H,14,15);1-2H3;/b9-8+;; |
| InChIKey | QSQUASQBHQDKBJ-YEUQMBKVSA-N |
| XLogP | 1.87 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-amino-3-(2-amino-4-methylphenyl)-3-hydroxyprop-2-enoic acid;ethane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-amino-3-(2-amino-4-methylphenyl)-3-hydroxyprop-2-enoic acid;ethane;yttrium?
The IUPAC name of (E)-2-amino-3-(2-amino-4-methylphenyl)-3-hydroxyprop-2-enoic acid;ethane;yttrium (CID 142087139) is (E)-2-amino-3-(2-amino-4-methylphenyl)-3-hydroxyprop-2-enoic acid;ethane;yttrium.
What is the SMILES notation for (E)-2-amino-3-(2-amino-4-methylphenyl)-3-hydroxyprop-2-enoic acid;ethane;yttrium?
The canonical SMILES for (E)-2-amino-3-(2-amino-4-methylphenyl)-3-hydroxyprop-2-enoic acid;ethane;yttrium is CC.Cc1ccc(/C(O)=C(\N)C(=O)O)c(N)c1.[Y].
What is the InChIKey of (E)-2-amino-3-(2-amino-4-methylphenyl)-3-hydroxyprop-2-enoic acid;ethane;yttrium?
The InChIKey is QSQUASQBHQDKBJ-YEUQMBKVSA-N. The full InChI is InChI=1S/C10H12N2O3.C2H6.Y/c1-5-2-3-6(7(11)4-5)9(13)8(12)10(14)15;1-2;/h2-4,13H,11-12H2,1H3,(H,14,15);1-2H3;/b9-8+;;.
What are the key properties of (E)-2-amino-3-(2-amino-4-methylphenyl)-3-hydroxyprop-2-enoic acid;ethane;yttrium?
(E)-2-amino-3-(2-amino-4-methylphenyl)-3-hydroxyprop-2-enoic acid;ethane;yttrium has a molecular weight of 327.19 g/mol, XLogP of 1.87, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-amino-3-(2-amino-4-methylphenyl)-3-hydroxyprop-2-enoic acid;ethane;yttrium is sourced from PubChem (CID 142087139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).