C7H10N2 — CID 142088261
4,5-dimethyl-4H-1,3-diazepine (PubChem CID 142088261) has the molecular formula C7H10N2 and a molecular weight of 122.17 g/mol. Its IUPAC name is 4,5-dimethyl-4H-1,3-diazepine.
| Compound Name | 4,5-dimethyl-4H-1,3-diazepine |
|---|---|
| PubChem CID | 142088261 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 4,5-dimethyl-4H-1,3-diazepine |
| SMILES | CC1=CC=NC=NC1C |
| InChI | InChI=1S/C7H10N2/c1-6-3-4-8-5-9-7(6)2/h3-5,7H,1-2H3 |
| InChIKey | QBZYNKXBGUCGGK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |