C8H12N2 — CID 142223515
2,4,6-trimethyl-4H-1,3-diazepine (PubChem CID 142223515) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 2,4,6-trimethyl-4H-1,3-diazepine.
| Compound Name | 2,4,6-trimethyl-4H-1,3-diazepine |
|---|---|
| PubChem CID | 142223515 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 2,4,6-trimethyl-4H-1,3-diazepine |
| SMILES | CC1=CC(C)N=C(C)N=C1 |
| InChI | InChI=1S/C8H12N2/c1-6-4-7(2)10-8(3)9-5-6/h4-5,7H,1-3H3 |
| InChIKey | AEBXKUJZBNNZFK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |