C11H16N2 — CID 123185222
N-(3-methylbut-3-enyl)-3,4-dihydroazepin-2-imine (PubChem CID 123185222) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is N-(3-methylbut-3-enyl)-3,4-dihydroazepin-2-imine.
| Compound Name | N-(3-methylbut-3-enyl)-3,4-dihydroazepin-2-imine |
|---|---|
| PubChem CID | 123185222 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N-(3-methylbut-3-enyl)-3,4-dihydroazepin-2-imine |
| SMILES | C=C(C)CC/N=C1\CCC=CC=N1 |
| InChI | InChI=1S/C11H16N2/c1-10(2)7-9-13-11-6-4-3-5-8-12-11/h3,5,8H,1,4,6-7,9H2,2H3/b13-11+ |
| InChIKey | JIICWGGFFYBAHJ-ACCUITESSA-N |
| XLogP | 2.77 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|