C11H15N3 — CID 142962297
N-[1-(2,3-dihydropyridin-5-yl)prop-2-enylidene]-N'-methylethanimidamide (PubChem CID 142962297) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is N-[1-(2,3-dihydropyridin-5-yl)prop-2-enylidene]-N'-methylethanimidamide.
| Compound Name | N-[1-(2,3-dihydropyridin-5-yl)prop-2-enylidene]-N'-methylethanimidamide |
|---|---|
| PubChem CID | 142962297 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | N-[1-(2,3-dihydropyridin-5-yl)prop-2-enylidene]-N'-methylethanimidamide |
| SMILES | C=C/C(=N\C(C)=N\C)C1=CCCN=C1 |
| InChI | InChI=1S/C11H15N3/c1-4-11(14-9(2)12-3)10-6-5-7-13-8-10/h4,6,8H,1,5,7H2,2-3H3/b12-9+,14-11+ |
| InChIKey | SSEGBCKMNFIZOV-JZAGDRGGSA-N |
| XLogP | 2.06 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|