C11H16N2 — CID 123513203
4-[(2E)-hepta-2,5-dien-2-yl]-2-methyl-2H-imidazole (PubChem CID 123513203) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 4-[(2E)-hepta-2,5-dien-2-yl]-2-methyl-2H-imidazole.
| Compound Name | 4-[(2E)-hepta-2,5-dien-2-yl]-2-methyl-2H-imidazole |
|---|---|
| PubChem CID | 123513203 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 4-[(2E)-hepta-2,5-dien-2-yl]-2-methyl-2H-imidazole |
| SMILES | CC=CC/C=C(\C)C1=NC(C)N=C1 |
| InChI | InChI=1S/C11H16N2/c1-4-5-6-7-9(2)11-8-12-10(3)13-11/h4-5,7-8,10H,6H2,1-3H3/b5-4?,9-7+ |
| InChIKey | YFWCEZLYLZCDHT-VZUAUHPGSA-N |
| XLogP | 2.77 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|