C8H12N2 — CID 147763095
2,7-dimethyl-4,5-dihydro-1,3-diazocine (PubChem CID 147763095) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 2,7-dimethyl-4,5-dihydro-1,3-diazocine.
| Compound Name | 2,7-dimethyl-4,5-dihydro-1,3-diazocine |
|---|---|
| PubChem CID | 147763095 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 2,7-dimethyl-4,5-dihydro-1,3-diazocine |
| SMILES | CC1=CCC/N=C(C)\N=C/1 |
| InChI | InChI=1S/C8H12N2/c1-7-4-3-5-9-8(2)10-6-7/h4,6H,3,5H2,1-2H3/b7-4?,9-8-,10-6- |
| InChIKey | HELRKMGZLAOIPQ-MCABROOJSA-N |
| XLogP | 1.83 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |