C7H14N2 — CID 142088782
methane;(1Z)-3-methyl-1-(methylideneamino)buta-1,3-dien-1-amine (PubChem CID 142088782) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is methane;(1Z)-3-methyl-1-(methylideneamino)buta-1,3-dien-1-amine.
| Compound Name | methane;(1Z)-3-methyl-1-(methylideneamino)buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 142088782 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | methane;(1Z)-3-methyl-1-(methylideneamino)buta-1,3-dien-1-amine |
| SMILES | C.C=N/C(N)=C\C(=C)C |
| InChI | InChI=1S/C6H10N2.CH4/c1-5(2)4-6(7)8-3;/h4H,1,3,7H2,2H3;1H4/b6-4-; |
| InChIKey | STMWPGKYXGXMEO-YHSAGPEESA-N |
| XLogP | 1.70 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|