C6H10N2 — CID 142970723
(1Z)-2-methyl-1-(methylideneamino)buta-1,3-dien-1-amine (PubChem CID 142970723) has the molecular formula C6H10N2 and a molecular weight of 110.16 g/mol. Its IUPAC name is (1Z)-2-methyl-1-(methylideneamino)buta-1,3-dien-1-amine.
| Compound Name | (1Z)-2-methyl-1-(methylideneamino)buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 142970723 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | (1Z)-2-methyl-1-(methylideneamino)buta-1,3-dien-1-amine |
| SMILES | C=C/C(C)=C(/N)N=C |
| InChI | InChI=1S/C6H10N2/c1-4-5(2)6(7)8-3/h4H,1,3,7H2,2H3/b6-5- |
| InChIKey | YQIJWYFHBRZBIX-WAYWQWQTSA-N |
| XLogP | 1.06 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|