C6H11N3 — CID 143501883
(E)-2-ethenyl-1-(methylideneamino)prop-1-ene-1,3-diamine (PubChem CID 143501883) has the molecular formula C6H11N3 and a molecular weight of 125.17 g/mol. Its IUPAC name is (E)-2-ethenyl-1-(methylideneamino)prop-1-ene-1,3-diamine.
| Compound Name | (E)-2-ethenyl-1-(methylideneamino)prop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 143501883 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | (E)-2-ethenyl-1-(methylideneamino)prop-1-ene-1,3-diamine |
| SMILES | C=C/C(CN)=C(/N)N=C |
| InChI | InChI=1S/C6H11N3/c1-3-5(4-7)6(8)9-2/h3H,1-2,4,7-8H2/b6-5+ |
| InChIKey | BHUNTLJVYRGICT-AATRIKPKSA-N |
| XLogP | 0.00 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|