About (E)-2-ethenyl-N'-methyl-1-(methylideneamino)prop-1-ene-1,3-diamine
(E)-2-ethenyl-N'-methyl-1-(methylideneamino)prop-1-ene-1,3-diamine (PubChem CID 143958095) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is (E)-2-ethenyl-N'-methyl-1-(methylideneamino)prop-1-ene-1,3-diamine.
Molecular Properties
| Compound Name | (E)-2-ethenyl-N'-methyl-1-(methylideneamino)prop-1-ene-1,3-diamine |
| PubChem CID | 143958095 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | (E)-2-ethenyl-N'-methyl-1-(methylideneamino)prop-1-ene-1,3-diamine |
| SMILES | C=C/C(CNC)=C(/N)N=C |
| InChI | InChI=1S/C7H13N3/c1-4-6(5-9-2)7(8)10-3/h4,9H,1,3,5,8H2,2H3/b7-6+ |
| InChIKey | SIPGXOUPPYOMSH-VOTSOKGWSA-N |
| XLogP | 0.26 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-ethenyl-N'-methyl-1-(methylideneamino)prop-1-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-ethenyl-N'-methyl-1-(methylideneamino)prop-1-ene-1,3-diamine?
The IUPAC name of (E)-2-ethenyl-N'-methyl-1-(methylideneamino)prop-1-ene-1,3-diamine (CID 143958095) is (E)-2-ethenyl-N'-methyl-1-(methylideneamino)prop-1-ene-1,3-diamine.
What is the SMILES notation for (E)-2-ethenyl-N'-methyl-1-(methylideneamino)prop-1-ene-1,3-diamine?
The canonical SMILES for (E)-2-ethenyl-N'-methyl-1-(methylideneamino)prop-1-ene-1,3-diamine is C=C/C(CNC)=C(/N)N=C.
What is the InChIKey of (E)-2-ethenyl-N'-methyl-1-(methylideneamino)prop-1-ene-1,3-diamine?
The InChIKey is SIPGXOUPPYOMSH-VOTSOKGWSA-N. The full InChI is InChI=1S/C7H13N3/c1-4-6(5-9-2)7(8)10-3/h4,9H,1,3,5,8H2,2H3/b7-6+.
What are the key properties of (E)-2-ethenyl-N'-methyl-1-(methylideneamino)prop-1-ene-1,3-diamine?
(E)-2-ethenyl-N'-methyl-1-(methylideneamino)prop-1-ene-1,3-diamine has a molecular weight of 139.20 g/mol, XLogP of 0.26, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-ethenyl-N'-methyl-1-(methylideneamino)prop-1-ene-1,3-diamine is sourced from PubChem (CID 143958095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).