C9H20N2 — CID 168926494
(1E)-2-methyl-1-(methylideneamino)buta-1,3-dien-1-amine;molecular hydrogen;propane (PubChem CID 168926494) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is (1E)-2-methyl-1-(methylideneamino)buta-1,3-dien-1-amine;molecular hydrogen;propane.
| Compound Name | (1E)-2-methyl-1-(methylideneamino)buta-1,3-dien-1-amine;molecular hydrogen;propane |
|---|---|
| PubChem CID | 168926494 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | (1E)-2-methyl-1-(methylideneamino)buta-1,3-dien-1-amine;molecular hydrogen;propane |
| SMILES | C=C/C(C)=C(\N)N=C.CCC.[H][H] |
| InChI | InChI=1S/C6H10N2.C3H8.H2/c1-4-5(2)6(7)8-3;1-3-2;/h4H,1,3,7H2,2H3;3H2,1-2H3;1H/b6-5+;; |
| InChIKey | VXPRAZMQMVZSRN-TXOOBNKBSA-N |
| XLogP | 2.73 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|