C11H20N2 — CID 144672554
ethane;2-ethenyl-1-[(Z)-propylideneamino]buta-1,3-dien-1-amine (PubChem CID 144672554) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is ethane;2-ethenyl-1-[(Z)-propylideneamino]buta-1,3-dien-1-amine.
| Compound Name | ethane;2-ethenyl-1-[(Z)-propylideneamino]buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 144672554 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | ethane;2-ethenyl-1-[(Z)-propylideneamino]buta-1,3-dien-1-amine |
| SMILES | C=CC(C=C)=C(N)/N=C\CC.CC |
| InChI | InChI=1S/C9H14N2.C2H6/c1-4-7-11-9(10)8(5-2)6-3;1-2/h5-7H,2-4,10H2,1H3;1-2H3/b11-7-; |
| InChIKey | VIXBYVKQRHJZEU-AJULUCINSA-N |
| XLogP | 3.04 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|