C11H24N2 — CID 144528004
ethane;(1Z)-1-[(Z)-ethylideneamino]-3-methylbuta-1,3-dien-1-amine (PubChem CID 144528004) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is ethane;(1Z)-1-[(Z)-ethylideneamino]-3-methylbuta-1,3-dien-1-amine.
| Compound Name | ethane;(1Z)-1-[(Z)-ethylideneamino]-3-methylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 144528004 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | ethane;(1Z)-1-[(Z)-ethylideneamino]-3-methylbuta-1,3-dien-1-amine |
| SMILES | C=C(C)/C=C(N)\N=C/C.CC.CC |
| InChI | InChI=1S/C7H12N2.2C2H6/c1-4-9-7(8)5-6(2)3;2*1-2/h4-5H,2,8H2,1,3H3;2*1-2H3/b7-5-,9-4-;; |
| InChIKey | HCWXYJIBMVFITL-LINJETDJSA-N |
| XLogP | 3.51 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|