C9H18N2 — CID 143422496
ethane;N'-[(Z)-3-methylbut-1-enyl]ethane-1,2-diimine (PubChem CID 143422496) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is ethane;N'-[(Z)-3-methylbut-1-enyl]ethane-1,2-diimine.
| Compound Name | ethane;N'-[(Z)-3-methylbut-1-enyl]ethane-1,2-diimine |
|---|---|
| PubChem CID | 143422496 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | ethane;N'-[(Z)-3-methylbut-1-enyl]ethane-1,2-diimine |
| SMILES | CC.[H]/N=C/C=N/C=C\C(C)C |
| InChI | InChI=1S/C7H12N2.C2H6/c1-7(2)3-5-9-6-4-8;1-2/h3-8H,1-2H3;1-2H3/b5-3-,8-4+,9-6+; |
| InChIKey | BYKOYZAKEROFCN-XNUULTQYSA-N |
| XLogP | 2.90 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|