C11H22N2 — CID 165400031
(1E)-N,2-dimethyl-1-[(Z)-propylideneamino]buta-1,3-dien-1-amine;ethane (PubChem CID 165400031) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is (1E)-N,2-dimethyl-1-[(Z)-propylideneamino]buta-1,3-dien-1-amine;ethane.
| Compound Name | (1E)-N,2-dimethyl-1-[(Z)-propylideneamino]buta-1,3-dien-1-amine;ethane |
|---|---|
| PubChem CID | 165400031 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | (1E)-N,2-dimethyl-1-[(Z)-propylideneamino]buta-1,3-dien-1-amine;ethane |
| SMILES | C=C/C(C)=C(/N=C\CC)NC.CC |
| InChI | InChI=1S/C9H16N2.C2H6/c1-5-7-11-9(10-4)8(3)6-2;1-2/h6-7,10H,2,5H2,1,3-4H3;1-2H3/b9-8+,11-7-; |
| InChIKey | POAHZPVDPHCGNR-LAYFAJFLSA-N |
| XLogP | 3.13 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|