C11H16N2 — CID 143533139
3-ethenyl-N,6,6-trimethylazepin-2-amine (PubChem CID 143533139) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 3-ethenyl-N,6,6-trimethylazepin-2-amine.
| Compound Name | 3-ethenyl-N,6,6-trimethylazepin-2-amine |
|---|---|
| PubChem CID | 143533139 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 3-ethenyl-N,6,6-trimethylazepin-2-amine |
| SMILES | C=CC1=C(NC)N=CC(C)(C)C=C1 |
| InChI | InChI=1S/C11H16N2/c1-5-9-6-7-11(2,3)8-13-10(9)12-4/h5-8,12H,1H2,2-4H3 |
| InChIKey | QDLNJHGBVVWAEB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |