C11H17N3 — CID 163856521
(1E)-2-(but-3-enylideneamino)-1-(ethylideneamino)-3-methylbuta-1,3-dien-1-amine (PubChem CID 163856521) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is (1E)-2-(but-3-enylideneamino)-1-(ethylideneamino)-3-methylbuta-1,3-dien-1-amine.
| Compound Name | (1E)-2-(but-3-enylideneamino)-1-(ethylideneamino)-3-methylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 163856521 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | (1E)-2-(but-3-enylideneamino)-1-(ethylideneamino)-3-methylbuta-1,3-dien-1-amine |
| SMILES | C=CC/C=N/C(C(=C)C)=C(\N)N=CC |
| InChI | InChI=1S/C11H17N3/c1-5-7-8-14-10(9(3)4)11(12)13-6-2/h5-6,8H,1,3,7,12H2,2,4H3/b11-10+,13-6?,14-8+ |
| InChIKey | OYTRNCJRGIGOLH-MICOXJMYSA-N |
| XLogP | 2.43 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|