C8H18N2 — CID 142089104
N',3-dimethylbut-2-enimidamide;ethane (PubChem CID 142089104) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is N',3-dimethylbut-2-enimidamide;ethane.
| Compound Name | N',3-dimethylbut-2-enimidamide;ethane |
|---|---|
| PubChem CID | 142089104 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | N',3-dimethylbut-2-enimidamide;ethane |
| SMILES | C/N=C(\N)C=C(C)C.CC |
| InChI | InChI=1S/C6H12N2.C2H6/c1-5(2)4-6(7)8-3;1-2/h4H,1-3H3,(H2,7,8);1-2H3 |
| InChIKey | LSXUDWJZHCTVMI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|