About (E)-N'-(4-aminobutyl)but-2-enimidamide
(E)-N'-(4-aminobutyl)but-2-enimidamide (PubChem CID 90846036) has the molecular formula C8H17N3
and a molecular weight of 155.25 g/mol. Its IUPAC name is (E)-N'-(4-aminobutyl)but-2-enimidamide.
Molecular Properties
| Compound Name | (E)-N'-(4-aminobutyl)but-2-enimidamide |
| PubChem CID | 90846036 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.25 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | (E)-N'-(4-aminobutyl)but-2-enimidamide |
| SMILES | C/C=C/C(N)=N/CCCCN |
| InChI | InChI=1S/C8H17N3/c1-2-5-8(10)11-7-4-3-6-9/h2,5H,3-4,6-7,9H2,1H3,(H2,10,11)/b5-2+ |
| InChIKey | LUJJWSRHRVAZBY-GORDUTHDSA-N |
| XLogP | 0.66 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-(4-aminobutyl)but-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-(4-aminobutyl)but-2-enimidamide?
The IUPAC name of (E)-N'-(4-aminobutyl)but-2-enimidamide (CID 90846036) is (E)-N'-(4-aminobutyl)but-2-enimidamide.
What is the SMILES notation for (E)-N'-(4-aminobutyl)but-2-enimidamide?
The canonical SMILES for (E)-N'-(4-aminobutyl)but-2-enimidamide is C/C=C/C(N)=N/CCCCN.
What is the InChIKey of (E)-N'-(4-aminobutyl)but-2-enimidamide?
The InChIKey is LUJJWSRHRVAZBY-GORDUTHDSA-N. The full InChI is InChI=1S/C8H17N3/c1-2-5-8(10)11-7-4-3-6-9/h2,5H,3-4,6-7,9H2,1H3,(H2,10,11)/b5-2+.
What are the key properties of (E)-N'-(4-aminobutyl)but-2-enimidamide?
(E)-N'-(4-aminobutyl)but-2-enimidamide has a molecular weight of 155.25 g/mol, XLogP of 0.66, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-(4-aminobutyl)but-2-enimidamide is sourced from PubChem (CID 90846036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).