C8H13N3 — CID 123830436
N'-(2-aminoethyl)hexa-2,4,5-trienimidamide (PubChem CID 123830436) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is N'-(2-aminoethyl)hexa-2,4,5-trienimidamide.
| Compound Name | N'-(2-aminoethyl)hexa-2,4,5-trienimidamide |
|---|---|
| PubChem CID | 123830436 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | N'-(2-aminoethyl)hexa-2,4,5-trienimidamide |
| SMILES | C=C=CC=C/C(N)=N\CCN |
| InChI | InChI=1S/C8H13N3/c1-2-3-4-5-8(10)11-7-6-9/h3-5H,1,6-7,9H2,(H2,10,11) |
| InChIKey | BTYAJSPNSOWHNU-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|