C7H10N2 — CID 126514165
(2Z)-N'-ethenylpenta-2,4-dienimidamide (PubChem CID 126514165) has the molecular formula C7H10N2 and a molecular weight of 122.17 g/mol. Its IUPAC name is (2Z)-N'-ethenylpenta-2,4-dienimidamide.
| Compound Name | (2Z)-N'-ethenylpenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 126514165 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | (2Z)-N'-ethenylpenta-2,4-dienimidamide |
| SMILES | C=C/C=C\C(N)=N\C=C |
| InChI | InChI=1S/C7H10N2/c1-3-5-6-7(8)9-4-2/h3-6H,1-2H2,(H2,8,9)/b6-5- |
| InChIKey | XBPWIOKGDWXBGH-WAYWQWQTSA-N |
| XLogP | 1.23 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|