C27H24FN7Na2O6S4 — CID 142090034
disodium;2-[(4-ethenylsulfanylphenyl)diazenyl]-8-[[4-[2-(2-ethenylsulfonylethoxy)ethylamino]-6-fluoro-1,3,5-triazin-2-yl]amino]-3,6-disulfenatonaphthalen-1-ol (PubChem CID 142090034) has the molecular formula C27H24FN7Na2O6S4 and a molecular weight of 735.78 g/mol. Its IUPAC name is disodium;2-[(4-ethenylsulfanylphenyl)diazenyl]-8-[[4-[2-(2-ethenylsulfonylethoxy)ethylamino]-6-fluoro-1,3,5-triazin-2-yl]amino]-3,6-disulfenatonaphthalen-1-ol.
| Compound Name | disodium;2-[(4-ethenylsulfanylphenyl)diazenyl]-8-[[4-[2-(2-ethenylsulfonylethoxy)ethylamino]-6-fluoro-1,3,5-triazin-2-yl]amino]-3,6-disulfenatonaphthalen-1-ol |
|---|---|
| PubChem CID | 142090034 |
| Molecular Formula | C27H24FN7Na2O6S4 |
| Molecular Weight | 735.78 g/mol |
| Exact Mass | 735.05 |
| IUPAC Name | disodium;2-[(4-ethenylsulfanylphenyl)diazenyl]-8-[[4-[2-(2-ethenylsulfonylethoxy)ethylamino]-6-fluoro-1,3,5-triazin-2-yl]amino]-3,6-disulfenatonaphthalen-1-ol |
| SMILES | C=CSc1ccc(/N=N/c2c(S[O-])cc3cc(S[O-])cc(Nc4nc(F)nc(NCCOCCS(=O)(=O)C=C)n4)c3c2O)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C27H26FN7O6S4.2Na/c1-3-42-18-7-5-17(6-8-18)34-35-23-21(44-38)14-16-13-19(43-37)15-20(22(16)24(23)36)30-27-32-25(28)31-26(33-27)29-9-10-41-11-12-45(39,40)4-2;;/h3-8,13-15,36-38H,1-2,9-12H2,(H2,29,30,31,32,33);;/q;2*+1/p-2/b35-34+;; |
| InChIKey | RPQWHJAAPVNDAA-KGNAMTJXSA-L |
| XLogP | 0.70 |
| TPSA | 197.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.78 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|