C22H32O2 — CID 142090114
8,13-dimethyl-7,12,14,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-3,17-diol;propane (PubChem CID 142090114) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is 8,13-dimethyl-7,12,14,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-3,17-diol;propane.
| Compound Name | 8,13-dimethyl-7,12,14,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-3,17-diol;propane |
|---|---|
| PubChem CID | 142090114 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 8,13-dimethyl-7,12,14,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-3,17-diol;propane |
| SMILES | CC12CCc3cc(O)ccc3C1=CCC1(C)C(O)CCC21.CCC |
| InChI | InChI=1S/C19H24O2.C3H8/c1-18-9-7-12-11-13(20)3-4-14(12)15(18)8-10-19(2)16(18)5-6-17(19)21;1-3-2/h3-4,8,11,16-17,20-21H,5-7,9-10H2,1-2H3;3H2,1-2H3 |
| InChIKey | AMQSPKZBYLAKSW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |