C16H20O2 — CID 57277252
(1S,3aS,7aS)-5-(4-hydroxyphenyl)-7a-methyl-1,2,3,3a,4,7-hexahydroinden-1-ol (PubChem CID 57277252) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (1S,3aS,7aS)-5-(4-hydroxyphenyl)-7a-methyl-1,2,3,3a,4,7-hexahydroinden-1-ol.
| Compound Name | (1S,3aS,7aS)-5-(4-hydroxyphenyl)-7a-methyl-1,2,3,3a,4,7-hexahydroinden-1-ol |
|---|---|
| PubChem CID | 57277252 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (1S,3aS,7aS)-5-(4-hydroxyphenyl)-7a-methyl-1,2,3,3a,4,7-hexahydroinden-1-ol |
| SMILES | C[C@]12CC=C(c3ccc(O)cc3)C[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C16H20O2/c1-16-9-8-12(10-13(16)4-7-15(16)18)11-2-5-14(17)6-3-11/h2-3,5-6,8,13,15,17-18H,4,7,9-10H2,1H3/t13-,15-,16-/m0/s1 |
| InChIKey | XBWTXUWSQSKTNB-BPUTZDHNSA-N |
| XLogP | 3.35 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |