C18H22O — CID 59912598
(8R,13R,14R)-13-methyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 59912598) has the molecular formula C18H22O and a molecular weight of 254.37 g/mol. Its IUPAC name is (8R,13R,14R)-13-methyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,13R,14R)-13-methyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 59912598 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | (8R,13R,14R)-13-methyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@@]12CC=C3c4ccccc4CC[C@@H]3[C@H]1CCC2O |
| InChI | InChI=1S/C18H22O/c1-18-11-10-14-13-5-3-2-4-12(13)6-7-15(14)16(18)8-9-17(18)19/h2-5,10,15-17,19H,6-9,11H2,1H3/t15-,16+,17?,18+/m0/s1 |
| InChIKey | MDHAPBUAVYKWFW-QXMSTZRJSA-N |
| XLogP | 3.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |