C25H28O2 — CID 10089941
(8S,13S,14S,17S)-13-methyl-3-phenylmethoxy-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 10089941) has the molecular formula C25H28O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is (8S,13S,14S,17S)-13-methyl-3-phenylmethoxy-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8S,13S,14S,17S)-13-methyl-3-phenylmethoxy-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 10089941 |
| Molecular Formula | C25H28O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | (8S,13S,14S,17S)-13-methyl-3-phenylmethoxy-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@]12CC=C3c4ccc(OCc5ccccc5)cc4CC[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C25H28O2/c1-25-14-13-21-20-10-8-19(27-16-17-5-3-2-4-6-17)15-18(20)7-9-22(21)23(25)11-12-24(25)26/h2-6,8,10,13,15,22-24,26H,7,9,11-12,14,16H2,1H3/t22-,23+,24+,25+/m1/s1 |
| InChIKey | ADHDVYVQLIMFHM-ROHNOIKCSA-N |
| XLogP | 5.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |