C20H28O — CID 91128042
ethane;(13S,14S)-13-methyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 91128042) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is ethane;(13S,14S)-13-methyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | ethane;(13S,14S)-13-methyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 91128042 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | ethane;(13S,14S)-13-methyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | CC.C[C@]12CC=C3c4ccccc4CCC3[C@@H]1CCC2O |
| InChI | InChI=1S/C18H22O.C2H6/c1-18-11-10-14-13-5-3-2-4-12(13)6-7-15(14)16(18)8-9-17(18)19;1-2/h2-5,10,15-17,19H,6-9,11H2,1H3;1-2H3/t15?,16-,17?,18-;/m0./s1 |
| InChIKey | WFELGUNPOPDJQL-GFCHTBATSA-N |
| XLogP | 4.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |