C17H23NO2 — CID 52947845
(1S,3bS,12aS)-1-hydroxy-12a-methyl-1,2,3,3a,3b,4,5,8,9,12-decahydroindeno[5,4-f]quinolizin-7-one (PubChem CID 52947845) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (1S,3bS,12aS)-1-hydroxy-12a-methyl-1,2,3,3a,3b,4,5,8,9,12-decahydroindeno[5,4-f]quinolizin-7-one.
| Compound Name | (1S,3bS,12aS)-1-hydroxy-12a-methyl-1,2,3,3a,3b,4,5,8,9,12-decahydroindeno[5,4-f]quinolizin-7-one |
|---|---|
| PubChem CID | 52947845 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (1S,3bS,12aS)-1-hydroxy-12a-methyl-1,2,3,3a,3b,4,5,8,9,12-decahydroindeno[5,4-f]quinolizin-7-one |
| SMILES | C[C@]12CC=C3[C@@H](CCC4=CC(=O)CCN43)C1CC[C@@H]2O |
| InChI | InChI=1S/C17H23NO2/c1-17-8-6-15-13(14(17)4-5-16(17)20)3-2-11-10-12(19)7-9-18(11)15/h6,10,13-14,16,20H,2-5,7-9H2,1H3/t13-,14?,16-,17-/m0/s1 |
| InChIKey | YDDJZOQHQXRIOZ-PEDUJENPSA-N |
| XLogP | 2.62 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |