C28H38O3 — CID 11868960
[(5S,8S,9R,10S,13S,14S,17S)-3-(4-methoxyphenyl)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 11868960) has the molecular formula C28H38O3 and a molecular weight of 422.61 g/mol. Its IUPAC name is [(5S,8S,9R,10S,13S,14S,17S)-3-(4-methoxyphenyl)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(5S,8S,9R,10S,13S,14S,17S)-3-(4-methoxyphenyl)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 11868960 |
| Molecular Formula | C28H38O3 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | [(5S,8S,9R,10S,13S,14S,17S)-3-(4-methoxyphenyl)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | COc1ccc(C2=CC[C@@]3(C)[C@@H](CC[C@H]4[C@H]3CC[C@]3(C)[C@@H](OC(C)=O)CC[C@@H]43)C2)cc1 |
| InChI | InChI=1S/C28H38O3/c1-18(29)31-26-12-11-24-23-10-7-21-17-20(19-5-8-22(30-4)9-6-19)13-15-27(21,2)25(23)14-16-28(24,26)3/h5-6,8-9,13,21,23-26H,7,10-12,14-17H2,1-4H3/t21-,23+,24-,25+,26-,27-,28-/m0/s1 |
| InChIKey | KXXIKUQRERCHIS-HPUCLRBXSA-N |
| XLogP | 6.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |