About 2-methylpropane;propane;prop-1-yne
2-methylpropane;propane;prop-1-yne (PubChem CID 142090542) has the molecular formula C13H30
and a molecular weight of 186.38 g/mol. Its IUPAC name is 2-methylpropane;propane;prop-1-yne.
Molecular Properties
| Compound Name | 2-methylpropane;propane;prop-1-yne |
| PubChem CID | 142090542 |
| Molecular Formula | C13H30 |
| Molecular Weight | 186.38 g/mol |
| Exact Mass | 186.23 |
| IUPAC Name | 2-methylpropane;propane;prop-1-yne |
| SMILES | C#CC.CC(C)C.CCC.CCC |
| InChI | InChI=1S/C4H10.2C3H8.C3H4/c1-4(2)3;3*1-3-2/h4H,1-3H3;2*3H2,1-2H3;1H,2H3 |
| InChIKey | CPQKRHZUCAUSOK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 186.38 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropane;propane;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;propane;prop-1-yne?
The IUPAC name of 2-methylpropane;propane;prop-1-yne (CID 142090542) is 2-methylpropane;propane;prop-1-yne.
What is the SMILES notation for 2-methylpropane;propane;prop-1-yne?
The canonical SMILES for 2-methylpropane;propane;prop-1-yne is C#CC.CC(C)C.CCC.CCC.
What is the InChIKey of 2-methylpropane;propane;prop-1-yne?
The InChIKey is CPQKRHZUCAUSOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.2C3H8.C3H4/c1-4(2)3;3*1-3-2/h4H,1-3H3;2*3H2,1-2H3;1H,2H3.
What are the key properties of 2-methylpropane;propane;prop-1-yne?
2-methylpropane;propane;prop-1-yne has a molecular weight of 186.38 g/mol, XLogP of 5.13, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;propane;prop-1-yne is sourced from PubChem (CID 142090542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).