C40H62N4O8 — CID 142090816
tert-butyl 3-[[3-[[(2S)-1-[3-cyclohexyl-2-[2-[3-(3-hydroxy-3-methylbutoxy)phenyl]ethylamino]propanoyl]pyrrolidine-2-carbonyl]amino]-2-oxohex-5-enoyl]amino]propanoate (PubChem CID 142090816) has the molecular formula C40H62N4O8 and a molecular weight of 726.96 g/mol. Its IUPAC name is tert-butyl 3-[[3-[[(2S)-1-[3-cyclohexyl-2-[2-[3-(3-hydroxy-3-methylbutoxy)phenyl]ethylamino]propanoyl]pyrrolidine-2-carbonyl]amino]-2-oxohex-5-enoyl]amino]propanoate.
| Compound Name | tert-butyl 3-[[3-[[(2S)-1-[3-cyclohexyl-2-[2-[3-(3-hydroxy-3-methylbutoxy)phenyl]ethylamino]propanoyl]pyrrolidine-2-carbonyl]amino]-2-oxohex-5-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 142090816 |
| Molecular Formula | C40H62N4O8 |
| Molecular Weight | 726.96 g/mol |
| Exact Mass | 726.46 |
| IUPAC Name | tert-butyl 3-[[3-[[(2S)-1-[3-cyclohexyl-2-[2-[3-(3-hydroxy-3-methylbutoxy)phenyl]ethylamino]propanoyl]pyrrolidine-2-carbonyl]amino]-2-oxohex-5-enoyl]amino]propanoate |
| SMILES | C=CCC(NC(=O)[C@@H]1CCCN1C(=O)C(CC1CCCCC1)NCCc1cccc(OCCC(C)(C)O)c1)C(=O)C(=O)NCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C40H62N4O8/c1-7-13-31(35(46)37(48)42-23-20-34(45)52-39(2,3)4)43-36(47)33-18-12-24-44(33)38(49)32(27-28-14-9-8-10-15-28)41-22-19-29-16-11-17-30(26-29)51-25-21-40(5,6)50/h7,11,16-17,26,28,31-33,41,50H,1,8-10,12-15,18-25,27H2,2-6H3,(H,42,48)(H,43,47)/t31?,32?,33-/m0/s1 |
| InChIKey | FRKCELDNVPORAH-PJUZOBRJSA-N |
| XLogP | 4.17 |
| TPSA | 163.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.96 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|