C34H48N4O8 — CID 142091007
benzyl 2-[3-[2-[ethyl-[2-[[2-[3-(3-hydroxypropoxy)phenyl]acetyl]amino]acetyl]amino]butanoylamino]hexanoylamino]acetate (PubChem CID 142091007) has the molecular formula C34H48N4O8 and a molecular weight of 640.78 g/mol. Its IUPAC name is benzyl 2-[3-[2-[ethyl-[2-[[2-[3-(3-hydroxypropoxy)phenyl]acetyl]amino]acetyl]amino]butanoylamino]hexanoylamino]acetate.
| Compound Name | benzyl 2-[3-[2-[ethyl-[2-[[2-[3-(3-hydroxypropoxy)phenyl]acetyl]amino]acetyl]amino]butanoylamino]hexanoylamino]acetate |
|---|---|
| PubChem CID | 142091007 |
| Molecular Formula | C34H48N4O8 |
| Molecular Weight | 640.78 g/mol |
| Exact Mass | 640.35 |
| IUPAC Name | benzyl 2-[3-[2-[ethyl-[2-[[2-[3-(3-hydroxypropoxy)phenyl]acetyl]amino]acetyl]amino]butanoylamino]hexanoylamino]acetate |
| SMILES | CCCC(CC(=O)NCC(=O)OCc1ccccc1)NC(=O)C(CC)N(CC)C(=O)CNC(=O)Cc1cccc(OCCCO)c1 |
| InChI | InChI=1S/C34H48N4O8/c1-4-12-27(21-31(41)36-23-33(43)46-24-25-13-8-7-9-14-25)37-34(44)29(5-2)38(6-3)32(42)22-35-30(40)20-26-15-10-16-28(19-26)45-18-11-17-39/h7-10,13-16,19,27,29,39H,4-6,11-12,17-18,20-24H2,1-3H3,(H,35,40)(H,36,41)(H,37,44) |
| InChIKey | QFYRDPRFFYBWOJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 163.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.78 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|