C26H27N2O5P — CID 142091333
4-[(4-acetylphenyl)-[4-(2-hydroxyethylcarbamoyl)phenyl]phosphanyl]-N-(2-hydroxyethyl)benzamide (PubChem CID 142091333) has the molecular formula C26H27N2O5P and a molecular weight of 478.49 g/mol. Its IUPAC name is 4-[(4-acetylphenyl)-[4-(2-hydroxyethylcarbamoyl)phenyl]phosphanyl]-N-(2-hydroxyethyl)benzamide.
| Compound Name | 4-[(4-acetylphenyl)-[4-(2-hydroxyethylcarbamoyl)phenyl]phosphanyl]-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 142091333 |
| Molecular Formula | C26H27N2O5P |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 4-[(4-acetylphenyl)-[4-(2-hydroxyethylcarbamoyl)phenyl]phosphanyl]-N-(2-hydroxyethyl)benzamide |
| SMILES | CC(=O)c1ccc(P(c2ccc(C(=O)NCCO)cc2)c2ccc(C(=O)NCCO)cc2)cc1 |
| InChI | InChI=1S/C26H27N2O5P/c1-18(31)19-2-8-22(9-3-19)34(23-10-4-20(5-11-23)25(32)27-14-16-29)24-12-6-21(7-13-24)26(33)28-15-17-30/h2-13,29-30H,14-17H2,1H3,(H,27,32)(H,28,33) |
| InChIKey | DAOXHZCIRZWHRO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|