C27H36N2O2 — CID 14209157
1-[(E)-3-(4-benzylpiperazin-1-yl)-1-(3-methoxyphenyl)prop-1-enyl]cyclohexan-1-ol (PubChem CID 14209157) has the molecular formula C27H36N2O2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 1-[(E)-3-(4-benzylpiperazin-1-yl)-1-(3-methoxyphenyl)prop-1-enyl]cyclohexan-1-ol.
| Compound Name | 1-[(E)-3-(4-benzylpiperazin-1-yl)-1-(3-methoxyphenyl)prop-1-enyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 14209157 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 1-[(E)-3-(4-benzylpiperazin-1-yl)-1-(3-methoxyphenyl)prop-1-enyl]cyclohexan-1-ol |
| SMILES | COc1cccc(/C(=C\CN2CCN(Cc3ccccc3)CC2)C2(O)CCCCC2)c1 |
| InChI | InChI=1S/C27H36N2O2/c1-31-25-12-8-11-24(21-25)26(27(30)14-6-3-7-15-27)13-16-28-17-19-29(20-18-28)22-23-9-4-2-5-10-23/h2,4-5,8-13,21,30H,3,6-7,14-20,22H2,1H3/b26-13+ |
| InChIKey | SXQGVJSBQVUAOY-LGJNPRDNSA-N |
| XLogP | 4.59 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |