C31H35N5O6S — CID 142092535
N-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methyl]formamide;N-(2-methyl-13-oxo-1-azatricyclo[7.4.1.05,14]tetradeca-5(14),6,8-trien-12-yl)-2,3-dihydro-1-benzofuran-5-sulfonamide (PubChem CID 142092535) has the molecular formula C31H35N5O6S and a molecular weight of 605.72 g/mol. Its IUPAC name is N-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methyl]formamide;N-(2-methyl-13-oxo-1-azatricyclo[7.4.1.05,14]tetradeca-5(14),6,8-trien-12-yl)-2,3-dihydro-1-benzofuran-5-sulfonamide.
| Compound Name | N-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methyl]formamide;N-(2-methyl-13-oxo-1-azatricyclo[7.4.1.05,14]tetradeca-5(14),6,8-trien-12-yl)-2,3-dihydro-1-benzofuran-5-sulfonamide |
|---|---|
| PubChem CID | 142092535 |
| Molecular Formula | C31H35N5O6S |
| Molecular Weight | 605.72 g/mol |
| Exact Mass | 605.23 |
| IUPAC Name | N-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methyl]formamide;N-(2-methyl-13-oxo-1-azatricyclo[7.4.1.05,14]tetradeca-5(14),6,8-trien-12-yl)-2,3-dihydro-1-benzofuran-5-sulfonamide |
| SMILES | CC1CCc2cccc3c2N1C(=O)C(NS(=O)(=O)c1ccc2c(c1)CCO2)CC3.N/C(=N\O)c1ccc(CNC=O)cc1 |
| InChI | InChI=1S/C22H24N2O4S.C9H11N3O2/c1-14-5-6-15-3-2-4-16-7-9-19(22(25)24(14)21(15)16)23-29(26,27)18-8-10-20-17(13-18)11-12-28-20;10-9(12-14)8-3-1-7(2-4-8)5-11-6-13/h2-4,8,10,13-14,19,23H,5-7,9,11-12H2,1H3;1-4,6,14H,5H2,(H2,10,12)(H,11,13) |
| InChIKey | OHDWROHVEGLQOC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 163.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.72 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|