C8H12N3OP — CID 142093582
6-methyl-3-(phosphanylamino)-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one (PubChem CID 142093582) has the molecular formula C8H12N3OP and a molecular weight of 197.18 g/mol. Its IUPAC name is 6-methyl-3-(phosphanylamino)-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one.
| Compound Name | 6-methyl-3-(phosphanylamino)-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 142093582 |
| Molecular Formula | C8H12N3OP |
| Molecular Weight | 197.18 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 6-methyl-3-(phosphanylamino)-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one |
| SMILES | CC1CCc2ncc(NP)c(=O)n21 |
| InChI | InChI=1S/C8H12N3OP/c1-5-2-3-7-9-4-6(10-13)8(12)11(5)7/h4-5,10H,2-3,13H2,1H3 |
| InChIKey | QOLJWVRVJOZLEB-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.18 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|