C9H12IN3O — CID 163608970
(6R)-3-[iodo(methyl)amino]-6-methyl-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one (PubChem CID 163608970) has the molecular formula C9H12IN3O and a molecular weight of 305.12 g/mol. Its IUPAC name is (6R)-3-[iodo(methyl)amino]-6-methyl-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one.
| Compound Name | (6R)-3-[iodo(methyl)amino]-6-methyl-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 163608970 |
| Molecular Formula | C9H12IN3O |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | (6R)-3-[iodo(methyl)amino]-6-methyl-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one |
| SMILES | C[C@@H]1CCc2ncc(N(C)I)c(=O)n21 |
| InChI | InChI=1S/C9H12IN3O/c1-6-3-4-8-11-5-7(12(2)10)9(14)13(6)8/h5-6H,3-4H2,1-2H3/t6-/m1/s1 |
| InChIKey | HEGLQDQFNHSNAL-ZCFIWIBFSA-N |
| XLogP | 1.54 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|